C12H14 — CID 57287069
1-(cyclobuten-1-ylmethyl)-4-methylbenzene (PubChem CID 57287069) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 1-(cyclobuten-1-ylmethyl)-4-methylbenzene.
| Compound Name | 1-(cyclobuten-1-ylmethyl)-4-methylbenzene |
|---|---|
| PubChem CID | 57287069 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1-(cyclobuten-1-ylmethyl)-4-methylbenzene |
| SMILES | Cc1ccc(CC2=CCC2)cc1 |
| InChI | InChI=1S/C12H14/c1-10-5-7-12(8-6-10)9-11-3-2-4-11/h3,5-8H,2,4,9H2,1H3 |
| InChIKey | DLTVLOPQEQQLDD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|