C22H46O8 — CID 57291363
3-(4,4-dibutoxy-1-ethoxy-2,4-dimethoxy-1-propoxybutoxy)propan-1-ol (PubChem CID 57291363) has the molecular formula C22H46O8 and a molecular weight of 438.60 g/mol. Its IUPAC name is 3-(4,4-dibutoxy-1-ethoxy-2,4-dimethoxy-1-propoxybutoxy)propan-1-ol.
| Compound Name | 3-(4,4-dibutoxy-1-ethoxy-2,4-dimethoxy-1-propoxybutoxy)propan-1-ol |
|---|---|
| PubChem CID | 57291363 |
| Molecular Formula | C22H46O8 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | 3-(4,4-dibutoxy-1-ethoxy-2,4-dimethoxy-1-propoxybutoxy)propan-1-ol |
| SMILES | CCCCOC(CC(OC)C(OCC)(OCCC)OCCCO)(OC)OCCCC |
| InChI | InChI=1S/C22H46O8/c1-7-11-16-27-21(25-6,28-17-12-8-2)19-20(24-5)22(26-10-4,29-15-9-3)30-18-13-14-23/h20,23H,7-19H2,1-6H3 |
| InChIKey | ULNAQSIJHRHJIE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|