C26H29BO3 — CID 57292416
4-ethenyl-1,6-diphenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 57292416) has the molecular formula C26H29BO3 and a molecular weight of 400.33 g/mol. Its IUPAC name is 4-ethenyl-1,6-diphenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 4-ethenyl-1,6-diphenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 57292416 |
| Molecular Formula | C26H29BO3 |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-ethenyl-1,6-diphenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | C=CC1=CC(B2OC(C)(C)C(C)(C)O2)(c2ccccc2)C(O)(c2ccccc2)C=C1 |
| InChI | InChI=1S/C26H29BO3/c1-6-20-17-18-26(28,22-15-11-8-12-16-22)25(19-20,21-13-9-7-10-14-21)27-29-23(2,3)24(4,5)30-27/h6-19,28H,1H2,2-5H3 |
| InChIKey | IWFYYRIUDKBEGY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|