C14H20O9 — CID 57296097
2-hydroxy-1-[(2R,3R,5R,6R)-2,5,6-triacetyl-3,4,5-trihydroxyoxan-2-yl]propan-1-one (PubChem CID 57296097) has the molecular formula C14H20O9 and a molecular weight of 332.31 g/mol. Its IUPAC name is 2-hydroxy-1-[(2R,3R,5R,6R)-2,5,6-triacetyl-3,4,5-trihydroxyoxan-2-yl]propan-1-one.
| Compound Name | 2-hydroxy-1-[(2R,3R,5R,6R)-2,5,6-triacetyl-3,4,5-trihydroxyoxan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 57296097 |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-hydroxy-1-[(2R,3R,5R,6R)-2,5,6-triacetyl-3,4,5-trihydroxyoxan-2-yl]propan-1-one |
| SMILES | CC(=O)[C@@H]1O[C@](C(C)=O)(C(=O)C(C)O)[C@H](O)C(O)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C14H20O9/c1-5(15)9(19)14(8(4)18)11(21)10(20)13(22,7(3)17)12(23-14)6(2)16/h5,10-12,15,20-22H,1-4H3/t5?,10?,11-,12+,13-,14-/m1/s1 |
| InChIKey | QGIOIBCGKMSCIK-DBCMWQDZSA-N |
| XLogP | -2.71 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|