C6H8O8S2-2 — CID 57300873
1,6-dihydroxy-1,6-dioxohexane-2,5-disulfinate (PubChem CID 57300873) has the molecular formula C6H8O8S2-2 and a molecular weight of 272.26 g/mol. Its IUPAC name is 1,6-dihydroxy-1,6-dioxohexane-2,5-disulfinate.
| Compound Name | 1,6-dihydroxy-1,6-dioxohexane-2,5-disulfinate |
|---|---|
| PubChem CID | 57300873 |
| Molecular Formula | C6H8O8S2-2 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 1,6-dihydroxy-1,6-dioxohexane-2,5-disulfinate |
| SMILES | O=C(O)C(CCC(C(=O)O)S(=O)[O-])S(=O)[O-] |
| InChI | InChI=1S/C6H10O8S2/c7-5(8)3(15(11)12)1-2-4(6(9)10)16(13)14/h3-4H,1-2H2,(H,7,8)(H,9,10)(H,11,12)(H,13,14)/p-2 |
| InChIKey | FOUZQCOEOGDHGC-UHFFFAOYSA-L |
| XLogP | -1.57 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|