C10H16N3O8S- — CID 57301347
2-[(4-amino-4-carboxybutanoyl)amino]-3-(carboxymethylamino)-3-oxopropane-1-sulfinate (PubChem CID 57301347) has the molecular formula C10H16N3O8S- and a molecular weight of 338.32 g/mol. Its IUPAC name is 2-[(4-amino-4-carboxybutanoyl)amino]-3-(carboxymethylamino)-3-oxopropane-1-sulfinate.
| Compound Name | 2-[(4-amino-4-carboxybutanoyl)amino]-3-(carboxymethylamino)-3-oxopropane-1-sulfinate |
|---|---|
| PubChem CID | 57301347 |
| Molecular Formula | C10H16N3O8S- |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-[(4-amino-4-carboxybutanoyl)amino]-3-(carboxymethylamino)-3-oxopropane-1-sulfinate |
| SMILES | NC(CCC(=O)NC(CS(=O)[O-])C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O8S/c11-5(10(18)19)1-2-7(14)13-6(4-22(20)21)9(17)12-3-8(15)16/h5-6H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)(H,20,21)/p-1 |
| InChIKey | DMAPAHUEYHXRFI-UHFFFAOYSA-M |
| XLogP | -3.26 |
| TPSA | 198.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|