C9H17NO8 — CID 57308596
3-[[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]amino]oxypropanoic acid (PubChem CID 57308596) has the molecular formula C9H17NO8 and a molecular weight of 267.23 g/mol. Its IUPAC name is 3-[[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]amino]oxypropanoic acid.
| Compound Name | 3-[[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]amino]oxypropanoic acid |
|---|---|
| PubChem CID | 57308596 |
| Molecular Formula | C9H17NO8 |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-[[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]amino]oxypropanoic acid |
| SMILES | O=C(O)CCON[C@@H](CO)C(=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H17NO8/c11-3-5(10-18-2-1-7(14)15)8(16)9(17)6(13)4-12/h5-6,9-13,17H,1-4H2,(H,14,15)/t5-,6+,9+/m0/s1 |
| InChIKey | PUXJMNFEEXGEJN-CCGCGBOQSA-N |
| XLogP | -3.37 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|