C21H21F3O2 — CID 57311135
4-[4-(phenylmethoxymethyl)-2-(trifluoromethyl)phenyl]cyclohexan-1-one (PubChem CID 57311135) has the molecular formula C21H21F3O2 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-[4-(phenylmethoxymethyl)-2-(trifluoromethyl)phenyl]cyclohexan-1-one.
| Compound Name | 4-[4-(phenylmethoxymethyl)-2-(trifluoromethyl)phenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 57311135 |
| Molecular Formula | C21H21F3O2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-[4-(phenylmethoxymethyl)-2-(trifluoromethyl)phenyl]cyclohexan-1-one |
| SMILES | O=C1CCC(c2ccc(COCc3ccccc3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H21F3O2/c22-21(23,24)20-12-16(14-26-13-15-4-2-1-3-5-15)6-11-19(20)17-7-9-18(25)10-8-17/h1-6,11-12,17H,7-10,13-14H2 |
| InChIKey | KRCWXGRWIKUGKG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |