C42H32O7 — CID 57314417
2-[2-[carboxy(diphenyl)methoxy]-2,2-diphenylacetyl]oxy-2,2-diphenylacetic acid (PubChem CID 57314417) has the molecular formula C42H32O7 and a molecular weight of 648.71 g/mol. Its IUPAC name is 2-[2-[carboxy(diphenyl)methoxy]-2,2-diphenylacetyl]oxy-2,2-diphenylacetic acid.
| Compound Name | 2-[2-[carboxy(diphenyl)methoxy]-2,2-diphenylacetyl]oxy-2,2-diphenylacetic acid |
|---|---|
| PubChem CID | 57314417 |
| Molecular Formula | C42H32O7 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | 2-[2-[carboxy(diphenyl)methoxy]-2,2-diphenylacetyl]oxy-2,2-diphenylacetic acid |
| SMILES | O=C(O)C(OC(=O)C(OC(C(=O)O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H32O7/c43-37(44)40(31-19-7-1-8-20-31,32-21-9-2-10-22-32)48-39(47)42(35-27-15-5-16-28-35,36-29-17-6-18-30-36)49-41(38(45)46,33-23-11-3-12-24-33)34-25-13-4-14-26-34/h1-30H,(H,43,44)(H,45,46) |
| InChIKey | JQZORGWTJMGNGE-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |