C28H35NS2 — CID 57318920
4-[5-[1-(4-heptylcyclohexyl)ethyl]thieno[3,2-b]thiophen-2-yl]benzonitrile (PubChem CID 57318920) has the molecular formula C28H35NS2 and a molecular weight of 449.73 g/mol. Its IUPAC name is 4-[5-[1-(4-heptylcyclohexyl)ethyl]thieno[3,2-b]thiophen-2-yl]benzonitrile.
| Compound Name | 4-[5-[1-(4-heptylcyclohexyl)ethyl]thieno[3,2-b]thiophen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 57318920 |
| Molecular Formula | C28H35NS2 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 4-[5-[1-(4-heptylcyclohexyl)ethyl]thieno[3,2-b]thiophen-2-yl]benzonitrile |
| SMILES | CCCCCCCC1CCC(C(C)c2cc3sc(-c4ccc(C#N)cc4)cc3s2)CC1 |
| InChI | InChI=1S/C28H35NS2/c1-3-4-5-6-7-8-21-9-13-23(14-10-21)20(2)25-17-27-28(30-25)18-26(31-27)24-15-11-22(19-29)12-16-24/h11-12,15-18,20-21,23H,3-10,13-14H2,1-2H3 |
| InChIKey | PPEHLRAHKSKRAV-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|