C22H26N2O4 — CID 57319668
2-(3-benzoylphenyl)propanoyl (2S)-2,6-diaminohexanoate (PubChem CID 57319668) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(3-benzoylphenyl)propanoyl (2S)-2,6-diaminohexanoate.
| Compound Name | 2-(3-benzoylphenyl)propanoyl (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 57319668 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-(3-benzoylphenyl)propanoyl (2S)-2,6-diaminohexanoate |
| SMILES | CC(C(=O)OC(=O)[C@@H](N)CCCCN)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H26N2O4/c1-15(21(26)28-22(27)19(24)12-5-6-13-23)17-10-7-11-18(14-17)20(25)16-8-3-2-4-9-16/h2-4,7-11,14-15,19H,5-6,12-13,23-24H2,1H3/t15?,19-/m0/s1 |
| InChIKey | OMALKRNSHWCSBC-FUBQLUNQSA-N |
| XLogP | 2.55 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|