C20H22O6 — CID 57323072
2-[2-[6-(2,3-dihydroxyphenyl)hexoxy]phenyl]-2-oxoacetic acid (PubChem CID 57323072) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-[2-[6-(2,3-dihydroxyphenyl)hexoxy]phenyl]-2-oxoacetic acid.
| Compound Name | 2-[2-[6-(2,3-dihydroxyphenyl)hexoxy]phenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 57323072 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[2-[6-(2,3-dihydroxyphenyl)hexoxy]phenyl]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)c1ccccc1OCCCCCCc1cccc(O)c1O |
| InChI | InChI=1S/C20H22O6/c21-16-11-7-9-14(18(16)22)8-3-1-2-6-13-26-17-12-5-4-10-15(17)19(23)20(24)25/h4-5,7,9-12,21-22H,1-3,6,8,13H2,(H,24,25) |
| InChIKey | OHRQYGJTWJVQNW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|