C25H34O4 — CID 57323533
(2R)-4-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-13-methyl-11-methylidene-3-oxo-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpent-4-enoic acid (PubChem CID 57323533) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is (2R)-4-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-13-methyl-11-methylidene-3-oxo-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpent-4-enoic acid.
| Compound Name | (2R)-4-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-13-methyl-11-methylidene-3-oxo-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpent-4-enoic acid |
|---|---|
| PubChem CID | 57323533 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (2R)-4-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-13-methyl-11-methylidene-3-oxo-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpent-4-enoic acid |
| SMILES | C=C1C[C@@]2(C)[C@@H](CC[C@@]2(O)C(=C)C[C@@H](C)C(=O)O)[C@@H]2CCC3=CC(=O)CC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C25H34O4/c1-14(23(27)28)11-16(3)25(29)10-9-21-20-7-5-17-12-18(26)6-8-19(17)22(20)15(2)13-24(21,25)4/h12,14,19-22,29H,2-3,5-11,13H2,1,4H3,(H,27,28)/t14-,19+,20+,21+,22-,24+,25-/m1/s1 |
| InChIKey | SDSYXIORKHHRLS-DLULJHKVSA-N |
| XLogP | 4.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|