C21H22F3NO7S — CID 57324450
2-[2-(oxan-2-yloxy)ethoxy]-5-[[4-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid (PubChem CID 57324450) has the molecular formula C21H22F3NO7S and a molecular weight of 489.47 g/mol. Its IUPAC name is 2-[2-(oxan-2-yloxy)ethoxy]-5-[[4-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[2-(oxan-2-yloxy)ethoxy]-5-[[4-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 57324450 |
| Molecular Formula | C21H22F3NO7S |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 2-[2-(oxan-2-yloxy)ethoxy]-5-[[4-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)ccc1OCCOC1CCCCO1 |
| InChI | InChI=1S/C21H22F3NO7S/c22-21(23,24)14-4-7-16(8-5-14)33(28,29)25-15-6-9-18(17(13-15)20(26)27)30-11-12-32-19-3-1-2-10-31-19/h4-9,13,19,25H,1-3,10-12H2,(H,26,27) |
| InChIKey | UCGZGIQDTXPILI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|