C34H52N2O8 — CID 57324589
N-[(2S,3S,4S,5S)-3,4-dihydroxy-5-[[2-(methoxymethoxy)-3-methylpentanoyl]amino]-1,6-diphenylhexan-2-yl]-2-(methoxymethoxy)-3-methylpentanamide (PubChem CID 57324589) has the molecular formula C34H52N2O8 and a molecular weight of 616.80 g/mol. Its IUPAC name is N-[(2S,3S,4S,5S)-3,4-dihydroxy-5-[[2-(methoxymethoxy)-3-methylpentanoyl]amino]-1,6-diphenylhexan-2-yl]-2-(methoxymethoxy)-3-methylpentanamide.
| Compound Name | N-[(2S,3S,4S,5S)-3,4-dihydroxy-5-[[2-(methoxymethoxy)-3-methylpentanoyl]amino]-1,6-diphenylhexan-2-yl]-2-(methoxymethoxy)-3-methylpentanamide |
|---|---|
| PubChem CID | 57324589 |
| Molecular Formula | C34H52N2O8 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.37 |
| IUPAC Name | N-[(2S,3S,4S,5S)-3,4-dihydroxy-5-[[2-(methoxymethoxy)-3-methylpentanoyl]amino]-1,6-diphenylhexan-2-yl]-2-(methoxymethoxy)-3-methylpentanamide |
| SMILES | CCC(C)C(OCOC)C(=O)N[C@@H](Cc1ccccc1)[C@H](O)[C@@H](O)[C@H](Cc1ccccc1)NC(=O)C(OCOC)C(C)CC |
| InChI | InChI=1S/C34H52N2O8/c1-7-23(3)31(43-21-41-5)33(39)35-27(19-25-15-11-9-12-16-25)29(37)30(38)28(20-26-17-13-10-14-18-26)36-34(40)32(24(4)8-2)44-22-42-6/h9-18,23-24,27-32,37-38H,7-8,19-22H2,1-6H3,(H,35,39)(H,36,40)/t23?,24?,27-,28-,29-,30-,31?,32?/m0/s1 |
| InChIKey | VCJWCEPJOYWKJQ-WBEIZIQUSA-N |
| XLogP | 3.23 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|