C22H37NO5SSi — CID 57331069
1-adamantyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidene-4-trimethylsilyloxybutanoate (PubChem CID 57331069) has the molecular formula C22H37NO5SSi and a molecular weight of 455.69 g/mol. Its IUPAC name is 1-adamantyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidene-4-trimethylsilyloxybutanoate.
| Compound Name | 1-adamantyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidene-4-trimethylsilyloxybutanoate |
|---|---|
| PubChem CID | 57331069 |
| Molecular Formula | C22H37NO5SSi |
| Molecular Weight | 455.69 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 1-adamantyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-sulfanylidene-4-trimethylsilyloxybutanoate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)OC12CC3CC(CC(C3)C1)C2)C(=S)O[Si](C)(C)C |
| InChI | InChI=1S/C22H37NO5SSi/c1-21(2,3)27-20(25)23-17(19(29)28-30(4,5)6)10-18(24)26-22-11-14-7-15(12-22)9-16(8-14)13-22/h14-17H,7-13H2,1-6H3,(H,23,25) |
| InChIKey | ZTPGJVVPHGBLEA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|