C14H14N2O5 — CID 57331450
2-methylpropyl N-(4-ethynyl-3-nitrobenzoyl)carbamate (PubChem CID 57331450) has the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. Its IUPAC name is 2-methylpropyl N-(4-ethynyl-3-nitrobenzoyl)carbamate.
| Compound Name | 2-methylpropyl N-(4-ethynyl-3-nitrobenzoyl)carbamate |
|---|---|
| PubChem CID | 57331450 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-methylpropyl N-(4-ethynyl-3-nitrobenzoyl)carbamate |
| SMILES | C#Cc1ccc(C(=O)NC(=O)OCC(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N2O5/c1-4-10-5-6-11(7-12(10)16(19)20)13(17)15-14(18)21-8-9(2)3/h1,5-7,9H,8H2,2-3H3,(H,15,17,18) |
| InChIKey | BKBPHRYFCGVGAK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|