C11H10N2O3 — CID 57331452
4-ethynyl-N,N-dimethyl-3-nitrobenzamide (PubChem CID 57331452) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 4-ethynyl-N,N-dimethyl-3-nitrobenzamide.
| Compound Name | 4-ethynyl-N,N-dimethyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 57331452 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4-ethynyl-N,N-dimethyl-3-nitrobenzamide |
| SMILES | C#Cc1ccc(C(=O)N(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10N2O3/c1-4-8-5-6-9(11(14)12(2)3)7-10(8)13(15)16/h1,5-7H,2-3H3 |
| InChIKey | ITMJYUVGWIMLEP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|