C6H12O4Se — CID 57331690
(2S,3R,4S,5R)-2-(hydroxymethyl)selenane-3,4,5-triol (PubChem CID 57331690) has the molecular formula C6H12O4Se and a molecular weight of 227.12 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(hydroxymethyl)selenane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-(hydroxymethyl)selenane-3,4,5-triol |
|---|---|
| PubChem CID | 57331690 |
| Molecular Formula | C6H12O4Se |
| Molecular Weight | 227.12 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | (2S,3R,4S,5R)-2-(hydroxymethyl)selenane-3,4,5-triol |
| SMILES | OC[C@@H]1[Se]C[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O4Se/c7-1-4-6(10)5(9)3(8)2-11-4/h3-10H,1-2H2/t3-,4-,5-,6-/m0/s1 |
| InChIKey | IYGOUMKNNPEILJ-BXKVDMCESA-N |
| XLogP | -2.01 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.12 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|