C11H22BrNO4 — CID 72943413
(2R,3R,4R,5R)-5-(hydroxymethyl)-6-azoniaspiro[5.5]undecane-2,3,4-triol bromide (PubChem CID 72943413) has the molecular formula C11H22BrNO4 and a molecular weight of 312.20 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(hydroxymethyl)-6-azoniaspiro[5.5]undecane-2,3,4-triol bromide.
| Compound Name | (2R,3R,4R,5R)-5-(hydroxymethyl)-6-azoniaspiro[5.5]undecane-2,3,4-triol bromide |
|---|---|
| PubChem CID | 72943413 |
| Molecular Formula | C11H22BrNO4 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | (2R,3R,4R,5R)-5-(hydroxymethyl)-6-azoniaspiro[5.5]undecane-2,3,4-triol bromide |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@H](O)C[N+]12CCCCC2.[Br-] |
| InChI | InChI=1S/C11H22NO4.BrH/c13-7-8-10(15)11(16)9(14)6-12(8)4-2-1-3-5-12;/h8-11,13-16H,1-7H2;1H/q+1;/p-1/t8-,9-,10-,11-;/m1./s1 |
| InChIKey | MTNGUJYXWVCTCO-PSQZEURLSA-M |
| XLogP | -4.55 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | -4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|