C10H20NO4+ — CID 72943542
(1S,2S,3S,4S)-1,4-bis(hydroxymethyl)-5-azoniaspiro[4.4]nonane-2,3-diol (PubChem CID 72943542) has the molecular formula C10H20NO4+ and a molecular weight of 218.27 g/mol. Its IUPAC name is (1S,2S,3S,4S)-1,4-bis(hydroxymethyl)-5-azoniaspiro[4.4]nonane-2,3-diol.
| Compound Name | (1S,2S,3S,4S)-1,4-bis(hydroxymethyl)-5-azoniaspiro[4.4]nonane-2,3-diol |
|---|---|
| PubChem CID | 72943542 |
| Molecular Formula | C10H20NO4+ |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (1S,2S,3S,4S)-1,4-bis(hydroxymethyl)-5-azoniaspiro[4.4]nonane-2,3-diol |
| SMILES | OC[C@H]1[C@H](O)[C@@H](O)[C@H](CO)[N+]12CCCC2 |
| InChI | InChI=1S/C10H20NO4/c12-5-7-9(14)10(15)8(6-13)11(7)3-1-2-4-11/h7-10,12-15H,1-6H2/q+1/t7-,8-,9-,10-/m0/s1 |
| InChIKey | YDJDAJKRSSOQRG-XKNYDFJKSA-N |
| XLogP | -1.95 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|