C11H7Br2NO5 — CID 57332751
(2R)-3,4-dibromo-2-[(S)-hydroxy-(4-nitrophenyl)methyl]-2H-furan-5-one (PubChem CID 57332751) has the molecular formula C11H7Br2NO5 and a molecular weight of 392.99 g/mol. Its IUPAC name is (2R)-3,4-dibromo-2-[(S)-hydroxy-(4-nitrophenyl)methyl]-2H-furan-5-one.
| Compound Name | (2R)-3,4-dibromo-2-[(S)-hydroxy-(4-nitrophenyl)methyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 57332751 |
| Molecular Formula | C11H7Br2NO5 |
| Molecular Weight | 392.99 g/mol |
| Exact Mass | 390.87 |
| IUPAC Name | (2R)-3,4-dibromo-2-[(S)-hydroxy-(4-nitrophenyl)methyl]-2H-furan-5-one |
| SMILES | O=C1O[C@H]([C@@H](O)c2ccc([N+](=O)[O-])cc2)C(Br)=C1Br |
| InChI | InChI=1S/C11H7Br2NO5/c12-7-8(13)11(16)19-10(7)9(15)5-1-3-6(4-2-5)14(17)18/h1-4,9-10,15H/t9-,10-/m0/s1 |
| InChIKey | OWYGUISOTPVTTM-UWVGGRQHSA-N |
| XLogP | 2.56 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.99 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|