C41H84NO2P2S+ — CID 57332833
2-[bis[(Z)-octadec-9-enoxy]phosphinothioylamino]ethyl-trimethylphosphanium (PubChem CID 57332833) has the molecular formula C41H84NO2P2S+ and a molecular weight of 717.14 g/mol. Its IUPAC name is 2-[bis[(Z)-octadec-9-enoxy]phosphinothioylamino]ethyl-trimethylphosphanium.
| Compound Name | 2-[bis[(Z)-octadec-9-enoxy]phosphinothioylamino]ethyl-trimethylphosphanium |
|---|---|
| PubChem CID | 57332833 |
| Molecular Formula | C41H84NO2P2S+ |
| Molecular Weight | 717.14 g/mol |
| Exact Mass | 716.57 |
| IUPAC Name | 2-[bis[(Z)-octadec-9-enoxy]phosphinothioylamino]ethyl-trimethylphosphanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=S)(NCC[P+](C)(C)C)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C41H84NO2P2S/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-39-43-46(47,42-38-41-45(3,4)5)44-40-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23H,6-19,24-41H2,1-5H3,(H,42,47)/q+1/b22-20-,23-21- |
| InChIKey | MJKPAQDLEGIAFS-YEUCEMRASA-N |
| XLogP | 14.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.14 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|