C15H18O4 — CID 57332897
[(5aR,9aR)-5a-(hydroxymethyl)-4-methoxy-6,9-dihydrodibenzofuran-9a-yl]methanol (PubChem CID 57332897) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is [(5aR,9aR)-5a-(hydroxymethyl)-4-methoxy-6,9-dihydrodibenzofuran-9a-yl]methanol.
| Compound Name | [(5aR,9aR)-5a-(hydroxymethyl)-4-methoxy-6,9-dihydrodibenzofuran-9a-yl]methanol |
|---|---|
| PubChem CID | 57332897 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [(5aR,9aR)-5a-(hydroxymethyl)-4-methoxy-6,9-dihydrodibenzofuran-9a-yl]methanol |
| SMILES | COc1cccc2c1O[C@]1(CO)CC=CC[C@]21CO |
| InChI | InChI=1S/C15H18O4/c1-18-12-6-4-5-11-13(12)19-15(10-17)8-3-2-7-14(11,15)9-16/h2-6,16-17H,7-10H2,1H3/t14-,15-/m0/s1 |
| InChIKey | YDNOKJKXVHTQPD-GJZGRUSLSA-N |
| XLogP | 1.40 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|