C15H18F6N4O4S — CID 57335530
1-[(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)sulfonylamino]-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea (PubChem CID 57335530) has the molecular formula C15H18F6N4O4S and a molecular weight of 464.39 g/mol. Its IUPAC name is 1-[(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)sulfonylamino]-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea.
| Compound Name | 1-[(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)sulfonylamino]-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 57335530 |
| Molecular Formula | C15H18F6N4O4S |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 1-[(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)sulfonylamino]-3-[1,1,1-trifluoro-2-(trifluoromethyl)butan-2-yl]urea |
| SMILES | CCC(NC(=O)NNS(=O)(=O)c1ccc2c(c1)OCCN2C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H18F6N4O4S/c1-3-13(14(16,17)18,15(19,20)21)22-12(26)23-24-30(27,28)9-4-5-10-11(8-9)29-7-6-25(10)2/h4-5,8,24H,3,6-7H2,1-2H3,(H2,22,23,26) |
| InChIKey | PUQDMCFSRNWIOK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|