C24H24N2O2 — CID 57338347
(3Z,5Z)-2,6-dibutyl-3,5-bis(prop-2-ynylidene)pyrrolo[3,4-f]isoindole-1,7-dione (PubChem CID 57338347) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (3Z,5Z)-2,6-dibutyl-3,5-bis(prop-2-ynylidene)pyrrolo[3,4-f]isoindole-1,7-dione.
| Compound Name | (3Z,5Z)-2,6-dibutyl-3,5-bis(prop-2-ynylidene)pyrrolo[3,4-f]isoindole-1,7-dione |
|---|---|
| PubChem CID | 57338347 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (3Z,5Z)-2,6-dibutyl-3,5-bis(prop-2-ynylidene)pyrrolo[3,4-f]isoindole-1,7-dione |
| SMILES | C#C/C=C1/c2cc3c(cc2C(=O)N1CCCC)C(=O)N(CCCC)/C3=C\C#C |
| InChI | InChI=1S/C24H24N2O2/c1-5-9-13-25-21(11-7-3)17-15-18-20(16-19(17)23(25)27)24(28)26(14-10-6-2)22(18)12-8-4/h3-4,11-12,15-16H,5-6,9-10,13-14H2,1-2H3/b21-11-,22-12- |
| InChIKey | VIBPRCZIRYNMIF-IINORCHSSA-N |
| XLogP | 4.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|