About 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene
1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene (PubChem CID 57338546) has the molecular formula C32H23Cl
and a molecular weight of 442.99 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene |
| PubChem CID | 57338546 |
| Molecular Formula | C32H23Cl |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene |
| SMILES | Cc1ccc2c(c1)C(c1ccccc1)c1c(-c3ccc(Cl)cc3)cc(-c3ccccc3)cc1-2 |
| InChI | InChI=1S/C32H23Cl/c1-21-12-17-27-29(18-21)31(24-10-6-3-7-11-24)32-28(23-13-15-26(33)16-14-23)19-25(20-30(27)32)22-8-4-2-5-9-22/h2-20,31H,1H3 |
| InChIKey | UMQUZADAQOLRHM-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene?
The IUPAC name of 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene (CID 57338546) is 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene.
What is the SMILES notation for 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene?
The canonical SMILES for 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene is Cc1ccc2c(c1)C(c1ccccc1)c1c(-c3ccc(Cl)cc3)cc(-c3ccccc3)cc1-2.
What is the InChIKey of 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene?
The InChIKey is UMQUZADAQOLRHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H23Cl/c1-21-12-17-27-29(18-21)31(24-10-6-3-7-11-24)32-28(23-13-15-26(33)16-14-23)19-25(20-30(27)32)22-8-4-2-5-9-22/h2-20,31H,1H3.
What are the key properties of 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene?
1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene has a molecular weight of 442.99 g/mol, XLogP of 9.14, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-7-methyl-3,9-diphenyl-9H-fluorene is sourced from PubChem (CID 57338546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).