C24H21NO4 — CID 57339690
(7-amino-1-benzoyloxy-5,6,7,8-tetrahydronaphthalen-2-yl) benzoate (PubChem CID 57339690) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is (7-amino-1-benzoyloxy-5,6,7,8-tetrahydronaphthalen-2-yl) benzoate.
| Compound Name | (7-amino-1-benzoyloxy-5,6,7,8-tetrahydronaphthalen-2-yl) benzoate |
|---|---|
| PubChem CID | 57339690 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (7-amino-1-benzoyloxy-5,6,7,8-tetrahydronaphthalen-2-yl) benzoate |
| SMILES | NC1CCc2ccc(OC(=O)c3ccccc3)c(OC(=O)c3ccccc3)c2C1 |
| InChI | InChI=1S/C24H21NO4/c25-19-13-11-16-12-14-21(28-23(26)17-7-3-1-4-8-17)22(20(16)15-19)29-24(27)18-9-5-2-6-10-18/h1-10,12,14,19H,11,13,15,25H2 |
| InChIKey | XWNUNQVSZJKLLO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|