C18H17BrF3NO2 — CID 57340518
(5S)-9-bromo-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol (PubChem CID 57340518) has the molecular formula C18H17BrF3NO2 and a molecular weight of 416.24 g/mol. Its IUPAC name is (5S)-9-bromo-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol.
| Compound Name | (5S)-9-bromo-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 57340518 |
| Molecular Formula | C18H17BrF3NO2 |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | (5S)-9-bromo-3-methyl-5-[3-(trifluoromethyl)phenyl]-1,2,4,5-tetrahydro-3-benzazepine-7,8-diol |
| SMILES | CN1CCc2c(cc(O)c(O)c2Br)[C@H](c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H17BrF3NO2/c1-23-6-5-12-13(8-15(24)17(25)16(12)19)14(9-23)10-3-2-4-11(7-10)18(20,21)22/h2-4,7-8,14,24-25H,5-6,9H2,1H3/t14-/m0/s1 |
| InChIKey | FTKZFGGKMRGKQD-AWEZNQCLSA-N |
| XLogP | 4.50 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|