C20H22Br2FN5OS — CID 57340819
N-[(4E)-1,3-dibromo-4-hydrazinylidene-5,6-dihydrocyclopenta[c]thiophen-6-yl]-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 57340819) has the molecular formula C20H22Br2FN5OS and a molecular weight of 559.30 g/mol. Its IUPAC name is N-[(4E)-1,3-dibromo-4-hydrazinylidene-5,6-dihydrocyclopenta[c]thiophen-6-yl]-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[(4E)-1,3-dibromo-4-hydrazinylidene-5,6-dihydrocyclopenta[c]thiophen-6-yl]-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 57340819 |
| Molecular Formula | C20H22Br2FN5OS |
| Molecular Weight | 559.30 g/mol |
| Exact Mass | 556.99 |
| IUPAC Name | N-[(4E)-1,3-dibromo-4-hydrazinylidene-5,6-dihydrocyclopenta[c]thiophen-6-yl]-2-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | N/N=C1\CC(NC(=O)CN2CCN(Cc3ccccc3F)CC2)c2c(Br)sc(Br)c21 |
| InChI | InChI=1S/C20H22Br2FN5OS/c21-19-17-14(9-15(26-24)18(17)20(22)30-19)25-16(29)11-28-7-5-27(6-8-28)10-12-3-1-2-4-13(12)23/h1-4,14H,5-11,24H2,(H,25,29)/b26-15+ |
| InChIKey | NDMCLOYIGVYROV-CVKSISIWSA-N |
| XLogP | 3.45 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|