C20H21Br2ClN4O4S — CID 11585269
N-(1,3-dibromo-4-oxo-5,6-dihydrocyclopenta[c]thiophen-6-yl)-2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]acetamide;hydrochloride (PubChem CID 11585269) has the molecular formula C20H21Br2ClN4O4S and a molecular weight of 608.74 g/mol. Its IUPAC name is N-(1,3-dibromo-4-oxo-5,6-dihydrocyclopenta[c]thiophen-6-yl)-2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(1,3-dibromo-4-oxo-5,6-dihydrocyclopenta[c]thiophen-6-yl)-2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 11585269 |
| Molecular Formula | C20H21Br2ClN4O4S |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 605.93 |
| IUPAC Name | N-(1,3-dibromo-4-oxo-5,6-dihydrocyclopenta[c]thiophen-6-yl)-2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCN(Cc2ccc([N+](=O)[O-])cc2)CC1)NC1CC(=O)c2c(Br)sc(Br)c21 |
| InChI | InChI=1S/C20H20Br2N4O4S.ClH/c21-19-17-14(9-15(27)18(17)20(22)31-19)23-16(28)11-25-7-5-24(6-8-25)10-12-1-3-13(4-2-12)26(29)30;/h1-4,14H,5-11H2,(H,23,28);1H |
| InChIKey | GXTQHVFTNVUIAJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|