C23H28ClNO6 — CID 57341722
methyl (2S)-2-[[2-(chloromethyl)-4,5-dimethoxyphenyl]methyl-ethoxycarbonylamino]-3-phenylpropanoate (PubChem CID 57341722) has the molecular formula C23H28ClNO6 and a molecular weight of 449.93 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(chloromethyl)-4,5-dimethoxyphenyl]methyl-ethoxycarbonylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[2-(chloromethyl)-4,5-dimethoxyphenyl]methyl-ethoxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 57341722 |
| Molecular Formula | C23H28ClNO6 |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | methyl (2S)-2-[[2-(chloromethyl)-4,5-dimethoxyphenyl]methyl-ethoxycarbonylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)N(Cc1cc(OC)c(OC)cc1CCl)[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C23H28ClNO6/c1-5-31-23(27)25(19(22(26)30-4)11-16-9-7-6-8-10-16)15-18-13-21(29-3)20(28-2)12-17(18)14-24/h6-10,12-13,19H,5,11,14-15H2,1-4H3/t19-/m0/s1 |
| InChIKey | QGONFKJAZSYEDF-IBGZPJMESA-N |
| XLogP | 4.19 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|