C40H42N2O7 — CID 57342193
(E,2R,5R)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(4-methoxyphenyl)-4-methyl-2-[3-(phenylmethoxycarbonylamino)propyl]hex-3-enoic acid (PubChem CID 57342193) has the molecular formula C40H42N2O7 and a molecular weight of 662.78 g/mol. Its IUPAC name is (E,2R,5R)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(4-methoxyphenyl)-4-methyl-2-[3-(phenylmethoxycarbonylamino)propyl]hex-3-enoic acid.
| Compound Name | (E,2R,5R)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(4-methoxyphenyl)-4-methyl-2-[3-(phenylmethoxycarbonylamino)propyl]hex-3-enoic acid |
|---|---|
| PubChem CID | 57342193 |
| Molecular Formula | C40H42N2O7 |
| Molecular Weight | 662.78 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | (E,2R,5R)-5-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(4-methoxyphenyl)-4-methyl-2-[3-(phenylmethoxycarbonylamino)propyl]hex-3-enoic acid |
| SMILES | COc1ccc(C[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)/C(C)=C/[C@@H](CCCNC(=O)OCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C40H42N2O7/c1-27(23-30(38(43)44)13-10-22-41-39(45)48-25-29-11-4-3-5-12-29)37(24-28-18-20-31(47-2)21-19-28)42-40(46)49-26-36-34-16-8-6-14-32(34)33-15-7-9-17-35(33)36/h3-9,11-12,14-21,23,30,36-37H,10,13,22,24-26H2,1-2H3,(H,41,45)(H,42,46)(H,43,44)/b27-23+/t30-,37-/m1/s1 |
| InChIKey | CEGIIKSAVHZHSF-KUHOTGKOSA-N |
| XLogP | 7.50 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.78 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|