C23H19NO2 — CID 57342816
[5-(4-methylphenyl)-2-phenyl-1,3-oxazol-4-yl]-phenylmethanol (PubChem CID 57342816) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is [5-(4-methylphenyl)-2-phenyl-1,3-oxazol-4-yl]-phenylmethanol.
| Compound Name | [5-(4-methylphenyl)-2-phenyl-1,3-oxazol-4-yl]-phenylmethanol |
|---|---|
| PubChem CID | 57342816 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [5-(4-methylphenyl)-2-phenyl-1,3-oxazol-4-yl]-phenylmethanol |
| SMILES | Cc1ccc(-c2oc(-c3ccccc3)nc2C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO2/c1-16-12-14-18(15-13-16)22-20(21(25)17-8-4-2-5-9-17)24-23(26-22)19-10-6-3-7-11-19/h2-15,21,25H,1H3 |
| InChIKey | CPMZHJHNZXAUPZ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |