C16H15N3O — CID 71295236
1-(2-phenyl-5-pyridin-3-yl-1,3-oxazol-4-yl)ethanamine (PubChem CID 71295236) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 1-(2-phenyl-5-pyridin-3-yl-1,3-oxazol-4-yl)ethanamine.
| Compound Name | 1-(2-phenyl-5-pyridin-3-yl-1,3-oxazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 71295236 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-(2-phenyl-5-pyridin-3-yl-1,3-oxazol-4-yl)ethanamine |
| SMILES | CC(N)c1nc(-c2ccccc2)oc1-c1cccnc1 |
| InChI | InChI=1S/C16H15N3O/c1-11(17)14-15(13-8-5-9-18-10-13)20-16(19-14)12-6-3-2-4-7-12/h2-11H,17H2,1H3 |
| InChIKey | LQLNRKLVKFNTCA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |