C26H35N3O3 — CID 57345232
6-[[5-[(dimethylamino)methyl]furan-2-yl]methyl-(2-naphthalen-1-ylethyl)amino]-N-hydroxyhexanamide (PubChem CID 57345232) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 6-[[5-[(dimethylamino)methyl]furan-2-yl]methyl-(2-naphthalen-1-ylethyl)amino]-N-hydroxyhexanamide.
| Compound Name | 6-[[5-[(dimethylamino)methyl]furan-2-yl]methyl-(2-naphthalen-1-ylethyl)amino]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 57345232 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 6-[[5-[(dimethylamino)methyl]furan-2-yl]methyl-(2-naphthalen-1-ylethyl)amino]-N-hydroxyhexanamide |
| SMILES | CN(C)Cc1ccc(CN(CCCCCC(=O)NO)CCc2cccc3ccccc23)o1 |
| InChI | InChI=1S/C26H35N3O3/c1-28(2)19-23-14-15-24(32-23)20-29(17-7-3-4-13-26(30)27-31)18-16-22-11-8-10-21-9-5-6-12-25(21)22/h5-6,8-12,14-15,31H,3-4,7,13,16-20H2,1-2H3,(H,27,30) |
| InChIKey | TXEIFNPLBMXPFX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|