C29H43N3O4 — CID 142707447
6-[4-(dimethylamino)butanoyl-(2-naphthalen-1-ylethyl)amino]-N-(oxan-2-yloxy)hexanamide (PubChem CID 142707447) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is 6-[4-(dimethylamino)butanoyl-(2-naphthalen-1-ylethyl)amino]-N-(oxan-2-yloxy)hexanamide.
| Compound Name | 6-[4-(dimethylamino)butanoyl-(2-naphthalen-1-ylethyl)amino]-N-(oxan-2-yloxy)hexanamide |
|---|---|
| PubChem CID | 142707447 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | 6-[4-(dimethylamino)butanoyl-(2-naphthalen-1-ylethyl)amino]-N-(oxan-2-yloxy)hexanamide |
| SMILES | CN(C)CCCC(=O)N(CCCCCC(=O)NOC1CCCCO1)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H43N3O4/c1-31(2)20-11-17-28(34)32(22-19-25-14-10-13-24-12-5-6-15-26(24)25)21-8-3-4-16-27(33)30-36-29-18-7-9-23-35-29/h5-6,10,12-15,29H,3-4,7-9,11,16-23H2,1-2H3,(H,30,33) |
| InChIKey | UYEVRIRHCBBOMG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|