C9H12O3 — CID 57345996
9-oxonona-5,7-dienoic acid (PubChem CID 57345996) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 9-oxonona-5,7-dienoic acid.
| Compound Name | 9-oxonona-5,7-dienoic acid |
|---|---|
| PubChem CID | 57345996 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 9-oxonona-5,7-dienoic acid |
| SMILES | O=CC=CC=CCCCC(=O)O |
| InChI | InChI=1S/C9H12O3/c10-8-6-4-2-1-3-5-7-9(11)12/h1-2,4,6,8H,3,5,7H2,(H,11,12) |
| InChIKey | ZYUGXBZTUPRCQT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|