C27H45NO3 — CID 57346587
2-(4-hydroxy-3-methoxyphenyl)icos-11-enamide (PubChem CID 57346587) has the molecular formula C27H45NO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxyphenyl)icos-11-enamide.
| Compound Name | 2-(4-hydroxy-3-methoxyphenyl)icos-11-enamide |
|---|---|
| PubChem CID | 57346587 |
| Molecular Formula | C27H45NO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)icos-11-enamide |
| SMILES | CCCCCCCCC=CCCCCCCCCC(C(N)=O)c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C27H45NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(27(28)30)23-20-21-25(29)26(22-23)31-2/h10-11,20-22,24,29H,3-9,12-19H2,1-2H3,(H2,28,30) |
| InChIKey | JFPHSRCDTFVLLE-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|