C27H30O4 — CID 162826227
1-(4-hydroxy-3-methoxyphenyl)-2-(7-hydroxynaphthalen-2-yl)dec-4-en-3-one (PubChem CID 162826227) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxyphenyl)-2-(7-hydroxynaphthalen-2-yl)dec-4-en-3-one.
| Compound Name | 1-(4-hydroxy-3-methoxyphenyl)-2-(7-hydroxynaphthalen-2-yl)dec-4-en-3-one |
|---|---|
| PubChem CID | 162826227 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)-2-(7-hydroxynaphthalen-2-yl)dec-4-en-3-one |
| SMILES | CCCCCC=CC(=O)C(Cc1ccc(O)c(OC)c1)c1ccc2ccc(O)cc2c1 |
| InChI | InChI=1S/C27H30O4/c1-3-4-5-6-7-8-25(29)24(15-19-9-14-26(30)27(16-19)31-2)21-11-10-20-12-13-23(28)18-22(20)17-21/h7-14,16-18,24,28,30H,3-6,15H2,1-2H3 |
| InChIKey | BLFRQMLUMMIKGD-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|