C32H40O4 — CID 163102607
(2R,9S)-1-(4-hydroxy-3-methoxyphenyl)-2-(7-hydroxynaphthalen-2-yl)-9-methyltetradec-4-en-3-one (PubChem CID 163102607) has the molecular formula C32H40O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is (2R,9S)-1-(4-hydroxy-3-methoxyphenyl)-2-(7-hydroxynaphthalen-2-yl)-9-methyltetradec-4-en-3-one.
| Compound Name | (2R,9S)-1-(4-hydroxy-3-methoxyphenyl)-2-(7-hydroxynaphthalen-2-yl)-9-methyltetradec-4-en-3-one |
|---|---|
| PubChem CID | 163102607 |
| Molecular Formula | C32H40O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | (2R,9S)-1-(4-hydroxy-3-methoxyphenyl)-2-(7-hydroxynaphthalen-2-yl)-9-methyltetradec-4-en-3-one |
| SMILES | CCCCC[C@H](C)CCCC=CC(=O)[C@H](Cc1ccc(O)c(OC)c1)c1ccc2ccc(O)cc2c1 |
| InChI | InChI=1S/C32H40O4/c1-4-5-7-10-23(2)11-8-6-9-12-30(34)29(19-24-13-18-31(35)32(20-24)36-3)26-15-14-25-16-17-28(33)22-27(25)21-26/h9,12-18,20-23,29,33,35H,4-8,10-11,19H2,1-3H3/t23-,29+/m0/s1 |
| InChIKey | OJPKQLQEEGLAGA-MUAVYFROSA-N |
| XLogP | 8.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|