C34H36O5 — CID 162898704
(E,2R)-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]-2-(7-hydroxynaphthalen-2-yl)dec-4-en-3-one (PubChem CID 162898704) has the molecular formula C34H36O5 and a molecular weight of 524.66 g/mol. Its IUPAC name is (E,2R)-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]-2-(7-hydroxynaphthalen-2-yl)dec-4-en-3-one.
| Compound Name | (E,2R)-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]-2-(7-hydroxynaphthalen-2-yl)dec-4-en-3-one |
|---|---|
| PubChem CID | 162898704 |
| Molecular Formula | C34H36O5 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | (E,2R)-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]-2-(7-hydroxynaphthalen-2-yl)dec-4-en-3-one |
| SMILES | CCCCC/C=C/C(=O)[C@H](Cc1ccc(O)c(OCCc2ccc(O)cc2)c1)c1ccc2ccc(O)cc2c1 |
| InChI | InChI=1S/C34H36O5/c1-2-3-4-5-6-7-32(37)31(27-12-11-26-13-16-30(36)23-28(26)22-27)20-25-10-17-33(38)34(21-25)39-19-18-24-8-14-29(35)15-9-24/h6-17,21-23,31,35-36,38H,2-5,18-20H2,1H3/b7-6+/t31-/m1/s1 |
| InChIKey | CSVZSFKOXPXORL-FLGLVYIJSA-N |
| XLogP | 7.61 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|