C26H34O5 — CID 163096912
11-hydroxy-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]dodec-4-en-3-one (PubChem CID 163096912) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is 11-hydroxy-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]dodec-4-en-3-one.
| Compound Name | 11-hydroxy-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]dodec-4-en-3-one |
|---|---|
| PubChem CID | 163096912 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 11-hydroxy-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]dodec-4-en-3-one |
| SMILES | CC(O)CCCCCC=CC(=O)CCc1ccc(O)c(OCCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C26H34O5/c1-20(27)7-5-3-2-4-6-8-23(28)15-11-22-12-16-25(30)26(19-22)31-18-17-21-9-13-24(29)14-10-21/h6,8-10,12-14,16,19-20,27,29-30H,2-5,7,11,15,17-18H2,1H3 |
| InChIKey | GNZIJILWPAEDNL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|