C38H47NO5 — CID 162831207
(E,9S)-1-[4-hydroxy-3-[2-[4-hydroxy-2-[7-(hydroxymethyl)-1H-indol-5-yl]phenyl]ethoxy]phenyl]-9-methyltetradec-4-en-3-one (PubChem CID 162831207) has the molecular formula C38H47NO5 and a molecular weight of 597.80 g/mol. Its IUPAC name is (E,9S)-1-[4-hydroxy-3-[2-[4-hydroxy-2-[7-(hydroxymethyl)-1H-indol-5-yl]phenyl]ethoxy]phenyl]-9-methyltetradec-4-en-3-one.
| Compound Name | (E,9S)-1-[4-hydroxy-3-[2-[4-hydroxy-2-[7-(hydroxymethyl)-1H-indol-5-yl]phenyl]ethoxy]phenyl]-9-methyltetradec-4-en-3-one |
|---|---|
| PubChem CID | 162831207 |
| Molecular Formula | C38H47NO5 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 597.35 |
| IUPAC Name | (E,9S)-1-[4-hydroxy-3-[2-[4-hydroxy-2-[7-(hydroxymethyl)-1H-indol-5-yl]phenyl]ethoxy]phenyl]-9-methyltetradec-4-en-3-one |
| SMILES | CCCCC[C@H](C)CCC/C=C/C(=O)CCc1ccc(O)c(OCCc2ccc(O)cc2-c2cc(CO)c3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C38H47NO5/c1-3-4-6-9-27(2)10-7-5-8-11-33(41)15-12-28-13-17-36(43)37(22-28)44-21-19-29-14-16-34(42)25-35(29)31-23-30-18-20-39-38(30)32(24-31)26-40/h8,11,13-14,16-18,20,22-25,27,39-40,42-43H,3-7,9-10,12,15,19,21,26H2,1-2H3/b11-8+/t27-/m0/s1 |
| InChIKey | JWDSDPVITNNMJU-HSDHKRTLSA-N |
| XLogP | 8.80 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|