C34H40N2O4 — CID 163126164
1-[4-hydroxy-3-[2-[4-hydroxy-2-(2H-indol-5-yl)phenyl]ethoxy]phenyl]-11-(methylamino)undec-4-en-3-one (PubChem CID 163126164) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is 1-[4-hydroxy-3-[2-[4-hydroxy-2-(2H-indol-5-yl)phenyl]ethoxy]phenyl]-11-(methylamino)undec-4-en-3-one.
| Compound Name | 1-[4-hydroxy-3-[2-[4-hydroxy-2-(2H-indol-5-yl)phenyl]ethoxy]phenyl]-11-(methylamino)undec-4-en-3-one |
|---|---|
| PubChem CID | 163126164 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | 1-[4-hydroxy-3-[2-[4-hydroxy-2-(2H-indol-5-yl)phenyl]ethoxy]phenyl]-11-(methylamino)undec-4-en-3-one |
| SMILES | CNCCCCCCC=CC(=O)CCc1ccc(O)c(OCCc2ccc(O)cc2-c2ccc3c(c2)=CCN=3)c1 |
| InChI | InChI=1S/C34H40N2O4/c1-35-19-7-5-3-2-4-6-8-29(37)13-9-25-10-16-33(39)34(22-25)40-21-18-26-11-14-30(38)24-31(26)27-12-15-32-28(23-27)17-20-36-32/h6,8,10-12,14-17,22-24,35,38-39H,2-5,7,9,13,18-21H2,1H3 |
| InChIKey | DJPGBGGECOHIED-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|