C31H37NO4 — CID 163096000
1-[3-[2-[3-[(4-aminophenyl)methyl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one (PubChem CID 163096000) has the molecular formula C31H37NO4 and a molecular weight of 487.64 g/mol. Its IUPAC name is 1-[3-[2-[3-[(4-aminophenyl)methyl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one.
| Compound Name | 1-[3-[2-[3-[(4-aminophenyl)methyl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one |
|---|---|
| PubChem CID | 163096000 |
| Molecular Formula | C31H37NO4 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 1-[3-[2-[3-[(4-aminophenyl)methyl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one |
| SMILES | CCCCCC=CC(=O)CCc1ccc(O)c(OCCc2ccc(O)c(Cc3ccc(N)cc3)c2)c1 |
| InChI | InChI=1S/C31H37NO4/c1-2-3-4-5-6-7-28(33)15-10-24-12-17-30(35)31(22-24)36-19-18-25-11-16-29(34)26(21-25)20-23-8-13-27(32)14-9-23/h6-9,11-14,16-17,21-22,34-35H,2-5,10,15,18-20,32H2,1H3 |
| InChIKey | LUTSPOCQOVCLHW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|