C41H49N3O6 — CID 162828834
1-[3-[2-[3-[6-(diaminomethyl)-4-(hydroxymethyl)-2-(1H-pyrrole-3-carbonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one (PubChem CID 162828834) has the molecular formula C41H49N3O6 and a molecular weight of 679.86 g/mol. Its IUPAC name is 1-[3-[2-[3-[6-(diaminomethyl)-4-(hydroxymethyl)-2-(1H-pyrrole-3-carbonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one.
| Compound Name | 1-[3-[2-[3-[6-(diaminomethyl)-4-(hydroxymethyl)-2-(1H-pyrrole-3-carbonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one |
|---|---|
| PubChem CID | 162828834 |
| Molecular Formula | C41H49N3O6 |
| Molecular Weight | 679.86 g/mol |
| Exact Mass | 679.36 |
| IUPAC Name | 1-[3-[2-[3-[6-(diaminomethyl)-4-(hydroxymethyl)-2-(1H-pyrrole-3-carbonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one |
| SMILES | CCCCCC=CC(=O)CCc1ccc(O)c(OCCc2ccc(O)c(C3c4ccc(C(N)N)cc4C(CO)CC3C(=O)c3cc[nH]c3)c2)c1 |
| InChI | InChI=1S/C41H49N3O6/c1-2-3-4-5-6-7-31(46)12-8-26-10-15-37(48)38(21-26)50-19-17-27-9-14-36(47)34(20-27)39-32-13-11-28(41(42)43)22-33(32)30(25-45)23-35(39)40(49)29-16-18-44-24-29/h6-7,9-11,13-16,18,20-22,24,30,35,39,41,44-45,47-48H,2-5,8,12,17,19,23,25,42-43H2,1H3 |
| InChIKey | JXOUDJLXPLHQHC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 171.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.86 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|