C40H49N3O6 — CID 162827889
(E,11S)-1-[3-[2-[3-[(1R)-1-[4-(diaminomethyl)phenyl]-3-oxo-3-(1H-pyrrol-3-yl)propyl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]-11-hydroxydodec-4-en-3-one (PubChem CID 162827889) has the molecular formula C40H49N3O6 and a molecular weight of 667.85 g/mol. Its IUPAC name is (E,11S)-1-[3-[2-[3-[(1R)-1-[4-(diaminomethyl)phenyl]-3-oxo-3-(1H-pyrrol-3-yl)propyl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]-11-hydroxydodec-4-en-3-one.
| Compound Name | (E,11S)-1-[3-[2-[3-[(1R)-1-[4-(diaminomethyl)phenyl]-3-oxo-3-(1H-pyrrol-3-yl)propyl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]-11-hydroxydodec-4-en-3-one |
|---|---|
| PubChem CID | 162827889 |
| Molecular Formula | C40H49N3O6 |
| Molecular Weight | 667.85 g/mol |
| Exact Mass | 667.36 |
| IUPAC Name | (E,11S)-1-[3-[2-[3-[(1R)-1-[4-(diaminomethyl)phenyl]-3-oxo-3-(1H-pyrrol-3-yl)propyl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]-11-hydroxydodec-4-en-3-one |
| SMILES | C[C@H](O)CCCCC/C=C/C(=O)CCc1ccc(O)c(OCCc2ccc(O)c([C@H](CC(=O)c3cc[nH]c3)c3ccc(C(N)N)cc3)c2)c1 |
| InChI | InChI=1S/C40H49N3O6/c1-27(44)7-5-3-2-4-6-8-33(45)16-9-28-11-18-37(47)39(24-28)49-22-20-29-10-17-36(46)35(23-29)34(25-38(48)32-19-21-43-26-32)30-12-14-31(15-13-30)40(41)42/h6,8,10-15,17-19,21,23-24,26-27,34,40,43-44,46-47H,2-5,7,9,16,20,22,25,41-42H2,1H3/b8-6+/t27-,34+/m0/s1 |
| InChIKey | GBWLUEZRJSIINP-HPTHGRNOSA-N |
| XLogP | 6.76 |
| TPSA | 171.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.85 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|