C42H49N3O5 — CID 162791796
1-[3-[2-[3-[1-amino-7-(1H-pyrrole-3-carbonyl)-1,2,3,4,6,7,8,9-octahydrobenzo[g]isoquinolin-6-yl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one (PubChem CID 162791796) has the molecular formula C42H49N3O5 and a molecular weight of 675.87 g/mol. Its IUPAC name is 1-[3-[2-[3-[1-amino-7-(1H-pyrrole-3-carbonyl)-1,2,3,4,6,7,8,9-octahydrobenzo[g]isoquinolin-6-yl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one.
| Compound Name | 1-[3-[2-[3-[1-amino-7-(1H-pyrrole-3-carbonyl)-1,2,3,4,6,7,8,9-octahydrobenzo[g]isoquinolin-6-yl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one |
|---|---|
| PubChem CID | 162791796 |
| Molecular Formula | C42H49N3O5 |
| Molecular Weight | 675.87 g/mol |
| Exact Mass | 675.37 |
| IUPAC Name | 1-[3-[2-[3-[1-amino-7-(1H-pyrrole-3-carbonyl)-1,2,3,4,6,7,8,9-octahydrobenzo[g]isoquinolin-6-yl]-4-hydroxyphenyl]ethoxy]-4-hydroxyphenyl]dec-4-en-3-one |
| SMILES | CCCCCC=CC(=O)CCc1ccc(O)c(OCCc2ccc(O)c(C3c4cc5c(cc4CCC3C(=O)c3cc[nH]c3)C(N)NCC5)c2)c1 |
| InChI | InChI=1S/C42H49N3O5/c1-2-3-4-5-6-7-32(46)12-8-27-10-15-38(48)39(23-27)50-21-18-28-9-14-37(47)36(22-28)40-33(41(49)31-16-19-44-26-31)13-11-29-25-35-30(24-34(29)40)17-20-45-42(35)43/h6-7,9-10,14-16,19,22-26,33,40,42,44-45,47-48H,2-5,8,11-13,17-18,20-21,43H2,1H3 |
| InChIKey | FCVRFWKCSYHSIH-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.87 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|