C32H38O4 — CID 162839419
(9R)-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]-9-methyl-11-phenylundec-4-en-3-one (PubChem CID 162839419) has the molecular formula C32H38O4 and a molecular weight of 486.65 g/mol. Its IUPAC name is (9R)-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]-9-methyl-11-phenylundec-4-en-3-one.
| Compound Name | (9R)-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]-9-methyl-11-phenylundec-4-en-3-one |
|---|---|
| PubChem CID | 162839419 |
| Molecular Formula | C32H38O4 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (9R)-1-[4-hydroxy-3-[2-(4-hydroxyphenyl)ethoxy]phenyl]-9-methyl-11-phenylundec-4-en-3-one |
| SMILES | C[C@H](CCCC=CC(=O)CCc1ccc(O)c(OCCc2ccc(O)cc2)c1)CCc1ccccc1 |
| InChI | InChI=1S/C32H38O4/c1-25(12-13-26-9-5-3-6-10-26)8-4-2-7-11-29(33)20-16-28-17-21-31(35)32(24-28)36-23-22-27-14-18-30(34)19-15-27/h3,5-7,9-11,14-15,17-19,21,24-25,34-35H,2,4,8,12-13,16,20,22-23H2,1H3/t25-/m1/s1 |
| InChIKey | YLKPDRBSGOFOHS-RUZDIDTESA-N |
| XLogP | 7.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|